![Fmoc-L-Lys[C20-OtBu-γ-Glu(OtBu)-AEEA-AEEA]-OH](/upload/2026/7/89-1.jpg "Fmoc-L-Lys[C20-OtBu-γ-Glu(OtBu)-AEEA-AEEA]-OH")
Fmoc-D-Aph(Cbm)-OH | CAS 324017-22-3
- cas：324017-22-3
- Molecular Formula：C25H23N3O5
- Purity：99%
- Molecular Weight：445.46722
This product is for research and development use only.
Product Details;
CasNo： 324017-22-3
Molecular Formula： C25H23N3O5
4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine Chemical Properties
|
Melting point |
163℃ (decomposition) |
|
Boiling point |
699.1±55.0 °C(Predicted) |
|
density |
1.376±0.06 g/cm3(Predicted) |
|
storage temp. |
2-8°C |
|
solubility |
DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
|
pka |
3.82±0.10(Predicted) |
|
form |
Solid |
|
color |
White to Off-White |
|
Stability: |
Hygroscopic |
|
InChIKey |
HFPDOFBZCSQAEJ-JOCHJYFZSA-N |
|
SMILES |
C(O)(=O)[C@@H](CC1=CC=C(NC(N)=O)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
4-[(AMinocarbonyl)aMino]-N-[(9H-fluoren-9-ylMethoxy)carbonyl]-D-phenylalanine Usage And Synthesis
|
Uses |
Fmoc-D-4-Aph(cBm)-OH is an amino acid derivative with an Fmoc protecting group, which can be used to synthesize biologically active peptide mimetics, such as Ac-D2Nal-D4Cpa-D3Pal-Ser-4Aph/4Amf(P)-D4Aph/D4Amf(Q)-Leu-ILys-Pro-DAla-NH2 with gonadotropin-releasing hormone (GnRH) antagonist activity[1]. |
|
References |
[1] Guangcheng Jiang, et al. "GnRH antagonists: a new generation of long acting analogues incorporating p-ureido-phenylalanines at positions 5 and 6." Journal of medicinal chemistry 44.3 (2001): 453-467. DOI:10.1021/jm0003900 |
Relevant Products
-
Fmoc-2-Nal-OHCAS：112883-43-9
-
Fmoc-4-Aph(L-Hor)-OHCAS：1253282-31-3
-
![Fmoc-L-Lys[Oct-OtBu-γ-Glu(OtBu)-AEEA-AEEA]-OH](/upload/2026/7/78-1.jpg "Fmoc-L-Lys[Oct-OtBu-γ-Glu(OtBu)-AEEA-AEEA]-OH")
Fmoc-L-Lys[Oct-OtBu-γ-Glu(OtBu)-AEEA-AEEA]-OHCAS：1662688-20-1
