![Fmoc-L-Lys[C20-OtBu-γ-Glu(OtBu)-AEEA-AEEA]-OH](/upload/2026/7/89-1.jpg "Fmoc-L-Lys[C20-OtBu-γ-Glu(OtBu)-AEEA-AEEA]-OH")
Fmoc-Glu(Otbu)-Gly-OH | CAS 866044-63-5
- cas：866044-63-5
- Molecular Formula：
- Purity：99%
- Molecular Weight：
This product is for research and development use only.
Product Details;
CasNo： 866044-63-5
Fmoc-Glu(OtBu)-Gly-OH Chemical Properties
|
Boiling point |
748.2±60.0 °C(Predicted) |
|
density |
1+-.0.06 g/cm3(Predicted) |
|
form |
Solid |
|
pka |
3.34±0.10(Predicted) |
|
InChIKey |
PLLNQUBUIXIMLG-DLINEHSKNA-N |
|
SMILES |
C(C1C2=CC=CC=C2C2=CC=CC=C12)OC(=O)N[C@H](C(=O)NCC(=O)O)CCC(=O)OC(C)(C)C |&1:18,r| |
Fmoc-Glu(OtBu)-Gly-OH Usage And Synthesis
|
Description |
Fmoc-Glu(OtBu)-OH is the glutamic acid deriviative used most often in solid phase peptide synthesis. |
|
Uses |
Fmoc-Glu(OtBu)-Gly-OH serves as a building block in the synthesis of peptides. It can be coupled with other amino acid residues to construct peptides with desired sequences. The Fmoc group acts as a protective group, allowing for selective deprotection and subsequent coupling reactions during solid-phase peptide synthesis. |
|
Definition |
Fmoc-Glu(OtBu)-Gly-OH is a small molecule polypeptide composed of two amino acids, with the amino group of the polypeptide being blocked. |
Relevant Products
-
Fmoc-His(trt)-Aib-OHCAS：1446013-13-3
-
Fmoc-Pro-Pro-Pro-OHCAS：134303-96-1
-
Fmoc-HIis-Aib-OH(TFA)CAS：1446013-08-6
-
Boc-His(trt)-Aib-Glu(Otbu)-Gly-OHCAS：1890228-73-5
